Products 2704345-20-8
CAS 2704345-20-8 is the registry number for 15-Keto Prostaglandin E0-d4. Offered by: TRC. Available pack sizes: 25mg.
3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]heptanoic acid (CAS 2704345-20-8) is a chemical compound with the molecular formula C20H34O5 and a molecular weight of 358.5 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]heptanoic acid. InChIKey: CDUVSQMTLOYKTR-GBXRSTSUSA-N.
| Molecular formula | C20H34O5 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-5-oxo-2-(3-oxooctyl)cyclopentyl]heptanoic acid |
| InChIKey | CDUVSQMTLOYKTR-GBXRSTSUSA-N |
| SMILES | [2H]C([2H])(CCC[C@@H]1[C@H]([C@@H](CC1=O)O)CCC(=O)CCCCC)C([2H])([2H])CC(=O)O |
Computed by PubChem (NCBI)