Products 2704631-18-3

CAS 2704631-18-3 is the registry number for 5-fluoro-6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

5-fluoro-6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 2704631-18-3) is a chemical compound with the molecular formula C8H6FN3O2 and a molecular weight of 195.15 g/mol. IUPAC name: 5-fluoro-6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: SSHJRIBHFDAOLG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6FN3O2
Molecular weight195.15 g/mol
IUPAC name5-fluoro-6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one
InChIKeySSHJRIBHFDAOLG-UHFFFAOYSA-N
SMILESCOC1=NC=C2C(=C1F)C(=O)NC=N2

Computed by PubChem (NCBI)