CAS 885522-68-9 appears in our catalog under these names: 6-Amino-4-fluoro-1H-indazole-3-carboxylic acid, 97%, 6-amino-4-fluoro-1H-indazole-3-carboxylic acid, 97%, 97%, 6-amino-4-fluoro-2H-indazole-3-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
6-amino-4-fluoro-1H-indazole-3-carboxylic acid (CAS 885522-68-9) is a chemical compound with the molecular formula C8H6FN3O2 and a molecular weight of 195.15 g/mol. IUPAC name: 6-amino-4-fluoro-1H-indazole-3-carboxylic acid. InChIKey: VMQHPGQGNLVKCC-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O2 |
|---|---|
| Molecular weight | 195.15 g/mol |
| IUPAC name | 6-amino-4-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | VMQHPGQGNLVKCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2C(=O)O)F)N |
Computed by PubChem (NCBI)