CAS 2704733-61-7 is the registry number for BB–22 6–hydroxyisoquinoline isomer. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
Isoquinolin-6-yl 1-(cyclohexylmethyl)indole-3-carboxylate (CAS 2704733-61-7) is a chemical compound with the molecular formula C25H24N2O2 and a molecular weight of 384.5 g/mol. IUPAC name: isoquinolin-6-yl 1-(cyclohexylmethyl)indole-3-carboxylate. InChIKey: VUCVJQBQZRPWSK-UHFFFAOYSA-N.
| Molecular formula | C25H24N2O2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | isoquinolin-6-yl 1-(cyclohexylmethyl)indole-3-carboxylate |
| InChIKey | VUCVJQBQZRPWSK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CN2C=C(C3=CC=CC=C32)C(=O)OC4=CC5=C(C=C4)C=NC=C5 |
Computed by PubChem (NCBI)