CAS 2708218-89-5 is the registry number for 1H,1H,2H,2H-Perfluorooctanesulfonic acid 13C2 (1,2-13C2) sodium 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
Sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octane-1-sulfonate (CAS 2708218-89-5) is a chemical compound with the molecular formula C8H4F13NaO3S and a molecular weight of 452.14 g/mol. IUPAC name: sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octane-1-sulfonate. InChIKey: CJZMVGPCWZSDSZ-AWQJXPNKSA-M.
| Molecular formula | C8H4F13NaO3S |
|---|---|
| Molecular weight | 452.14 g/mol |
| IUPAC name | sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octane-1-sulfonate |
| InChIKey | CJZMVGPCWZSDSZ-AWQJXPNKSA-M |
| SMILES | [13CH2]([13CH2]S(=O)(=O)[O-])C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)