CAS 27619-94-9 appears in our catalog under these names: 2-(Perfluorohexyl)ethane-1-sulfonic Acid Sodium Salt, >95% (HPLC), 1H,1H,2H,2H-Perfluorooctane sulfonic acid sodium 50 µg/mL in Methanol:Water. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg, 25mg, 1ml.
Sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonate (CAS 27619-94-9) is a chemical compound with the molecular formula C8H4F13NaO3S and a molecular weight of 450.15 g/mol. IUPAC name: sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonate. InChIKey: CJZMVGPCWZSDSZ-UHFFFAOYSA-M.
| Molecular formula | C8H4F13NaO3S |
|---|---|
| Molecular weight | 450.15 g/mol |
| IUPAC name | sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonate |
| InChIKey | CJZMVGPCWZSDSZ-UHFFFAOYSA-M |
| SMILES | C(CS(=O)(=O)[O-])C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)