Products 2708281-59-6
CAS 2708281-59-6 is the registry number for 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-amine,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-amine;dihydrochloride (CAS 2708281-59-6) is a chemical compound with the molecular formula C6H12Cl2N4 and a molecular weight of 211.09 g/mol. IUPAC name: 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-amine;dihydrochloride. InChIKey: GBDJFZPNJXQUDU-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4 |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-amine;dihydrochloride |
| InChIKey | GBDJFZPNJXQUDU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)N)CN1.Cl.Cl |
Computed by PubChem (NCBI)