CAS 2708283-39-8 appears in our catalog under these names: Sodium Phenyl-d5-glyoxylate, 99 atom % D, min 98% Chemical Purity, Phenylglyoxylic acid–d5 sodium, Phenylglyoxylic acid-d5(sodium), 99.79%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 50 mg, 10 mg, 5 mg, 25 mg.
Sodium 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate (CAS 2708283-39-8) is a chemical compound with the molecular formula C8H5NaO3 and a molecular weight of 177.14 g/mol. IUPAC name: sodium 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate. InChIKey: GGDFZLZSWSCHFU-GWVWGMRQSA-M.
| Molecular formula | C8H5NaO3 |
|---|---|
| Molecular weight | 177.14 g/mol |
| IUPAC name | sodium 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetate |
| InChIKey | GGDFZLZSWSCHFU-GWVWGMRQSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C(=O)[O-])[2H])[2H].[Na+] |
Computed by PubChem (NCBI)