CAS 43165-51-1 appears in our catalog under these names: Phenylglyoxylic acid (sodium), 98%, 98%, Phenylglyoxylic acid (sodium), 99.92%, Phenylglyoxylic acid (sodium), 98%, Sodium 2-oxo-2-phenylacetate, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500 mg.
Sodium 2-oxo-2-phenylacetate (CAS 43165-51-1) is a chemical compound with the molecular formula C8H5NaO3 and a molecular weight of 172.11 g/mol. IUPAC name: sodium 2-oxo-2-phenylacetate. InChIKey: GGDFZLZSWSCHFU-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO3 |
|---|---|
| Molecular weight | 172.11 g/mol |
| IUPAC name | sodium 2-oxo-2-phenylacetate |
| InChIKey | GGDFZLZSWSCHFU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)