CAS 2708283-70-7 appears in our catalog under these names: rel-(1R,3r,5S,8s)-3-Aminobicyclo(3.2.1)octan-8-ol hydrochloride, 95%, (1R,3S,5S,8R)-3-aminobicyclo[3.2.1]octan-8-ol hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(1R,5S)-3-aminobicyclo[3.2.1]octan-8-ol;hydrochloride (CAS 2708283-70-7) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: (1R,5S)-3-aminobicyclo[3.2.1]octan-8-ol;hydrochloride. InChIKey: HNZAXXDUKAMMSB-RHSYLKOPSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | (1R,5S)-3-aminobicyclo[3.2.1]octan-8-ol;hydrochloride |
| InChIKey | HNZAXXDUKAMMSB-RHSYLKOPSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1C2O)N.Cl |
Computed by PubChem (NCBI)