Products 2708287-66-3
CAS 2708287-66-3 appears in our catalog under these names: 3-(dimethylamino)bicyclo[1.1.1]pentane-1-carboxylic acid hydrochloride, 97%, 97%, 3-(DIMETHYLAMINO)BICYCLO[1.1.1]PENTANE-1-CARBOXYLIC ACID HYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
3-(dimethylamino)bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride (CAS 2708287-66-3) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 3-(dimethylamino)bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride. InChIKey: OLYCUILKUHFATK-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 3-(dimethylamino)bicyclo[1.1.1]pentane-1-carboxylic acid;hydrochloride |
| InChIKey | OLYCUILKUHFATK-UHFFFAOYSA-N |
| SMILES | CN(C)C12CC(C1)(C2)C(=O)O.Cl |
Computed by PubChem (NCBI)