Products 2708287-96-9
CAS 2708287-96-9 is the registry number for tert-butyl 2-imino-5-methyl-2H-1,3,4-thiadiazine-3(6H)-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 2-imino-5-methyl-6H-1,3,4-thiadiazine-3-carboxylate (CAS 2708287-96-9) is a chemical compound with the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. IUPAC name: tert-butyl 2-imino-5-methyl-6H-1,3,4-thiadiazine-3-carboxylate. InChIKey: RJOSOUXUKNKWDU-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | tert-butyl 2-imino-5-methyl-6H-1,3,4-thiadiazine-3-carboxylate |
| InChIKey | RJOSOUXUKNKWDU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N)SC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)