CAS 270928-69-3 appears in our catalog under these names: Sodium (2R,3S)-2,3,4-trihydroxy-3-methylbutyl phosphate, 98+%, Methyl-D-erythritol Phosphate Disodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
Disodium;(2,3,4-trihydroxy-3-methylbutyl) phosphate (CAS 270928-69-3) is a chemical compound with the molecular formula C5H11Na2O7P and a molecular weight of 260.09 g/mol. IUPAC name: disodium;(2,3,4-trihydroxy-3-methylbutyl) phosphate. InChIKey: XSGQWNNZXHPJOT-UHFFFAOYSA-L.
| Molecular formula | C5H11Na2O7P |
|---|---|
| Molecular weight | 260.09 g/mol |
| IUPAC name | disodium;(2,3,4-trihydroxy-3-methylbutyl) phosphate |
| InChIKey | XSGQWNNZXHPJOT-UHFFFAOYSA-L |
| SMILES | CC(CO)(C(COP(=O)([O-])[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)