CAS 72648-40-9 is the registry number for 1-Anthracenebutyric Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
Disodium;[(2R)-2,3,4-trihydroxy-3-methylbutyl] phosphate (CAS 72648-40-9) is a chemical compound with the molecular formula C5H11Na2O7P and a molecular weight of 260.09 g/mol. IUPAC name: disodium;[(2R)-2,3,4-trihydroxy-3-methylbutyl] phosphate. InChIKey: XSGQWNNZXHPJOT-LQAUIFMOSA-L.
| Molecular formula | C5H11Na2O7P |
|---|---|
| Molecular weight | 260.09 g/mol |
| IUPAC name | disodium;[(2R)-2,3,4-trihydroxy-3-methylbutyl] phosphate |
| InChIKey | XSGQWNNZXHPJOT-LQAUIFMOSA-L |
| SMILES | CC(CO)([C@@H](COP(=O)([O-])[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)