Products 2710685-19-9
CAS 2710685-19-9 is the registry number for 5-ethyl-2-fluoro-3-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
5-ethyl-2-fluoro-3-methylbenzoic acid (CAS 2710685-19-9) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 5-ethyl-2-fluoro-3-methylbenzoic acid. InChIKey: UOSAOZIZFZJOOS-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 5-ethyl-2-fluoro-3-methylbenzoic acid |
| InChIKey | UOSAOZIZFZJOOS-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)C)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Ethyl-2-fluoro-3-methylbenZoic acid