Products 2710812-77-2
CAS 2710812-77-2 is the registry number for (2,6-dichloro-3-ethylphenyl)(methyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-4-ethyl-2-methylsulfanylbenzene (CAS 2710812-77-2) is a chemical compound with the molecular formula C9H10Cl2S and a molecular weight of 221.15 g/mol. IUPAC name: 1,3-dichloro-4-ethyl-2-methylsulfanylbenzene. InChIKey: KKWXXNCGBMGKEF-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2S |
|---|---|
| Molecular weight | 221.15 g/mol |
| IUPAC name | 1,3-dichloro-4-ethyl-2-methylsulfanylbenzene |
| InChIKey | KKWXXNCGBMGKEF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)Cl)SC)Cl |
Computed by PubChem (NCBI)