CAS 99849-02-2 is the registry number for (2,4-Dichlorophenyl)(isopropyl)sulfane, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-dichloro-1-propan-2-ylsulfanylbenzene (CAS 99849-02-2) is a chemical compound with the molecular formula C9H10Cl2S and a molecular weight of 221.15 g/mol. IUPAC name: 2,4-dichloro-1-propan-2-ylsulfanylbenzene. InChIKey: WNAKNFCEFNKETQ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2S |
|---|---|
| Molecular weight | 221.15 g/mol |
| IUPAC name | 2,4-dichloro-1-propan-2-ylsulfanylbenzene |
| InChIKey | WNAKNFCEFNKETQ-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)