Products 2711962-89-7

CAS 2711962-89-7 is the registry number for 3-Methyl-4-((2-(piperazin-1-yl)phenyl)thio)benzoic acid, hydrochloride (1:2), >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

3-methyl-4-(2-piperazin-1-ylphenyl)sulfanylbenzoic acid (CAS 2711962-89-7) is a chemical compound with the molecular formula C18H20N2O2S and a molecular weight of 328.4 g/mol. IUPAC name: 3-methyl-4-(2-piperazin-1-ylphenyl)sulfanylbenzoic acid. InChIKey: ROOVDZHALVSNIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20N2O2S
Molecular weight328.4 g/mol
IUPAC name3-methyl-4-(2-piperazin-1-ylphenyl)sulfanylbenzoic acid
InChIKeyROOVDZHALVSNIQ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(=O)O)SC2=CC=CC=C2N3CCNCC3

Computed by PubChem (NCBI)