CAS 894351-85-0 is the registry number for N-Methyl-(2-(1-benzylindol-5-yl)ethane-1-sulfonamide. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-(1-benzylindol-5-yl)-N-methylethanesulfonamide (CAS 894351-85-0) is a chemical compound with the molecular formula C18H20N2O2S and a molecular weight of 328.4 g/mol. IUPAC name: 2-(1-benzylindol-5-yl)-N-methylethanesulfonamide. InChIKey: JAYORSKJTWWUMN-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-(1-benzylindol-5-yl)-N-methylethanesulfonamide |
| InChIKey | JAYORSKJTWWUMN-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(C=C1)N(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)