Products 27145-47-7

CAS 27145-47-7 is the registry number for 3-(Hydrazinecarbonyl)pyrazine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(hydrazinecarbonyl)pyrazine-2-carboxylic acid (CAS 27145-47-7) is a chemical compound with the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. IUPAC name: 3-(hydrazinecarbonyl)pyrazine-2-carboxylic acid. InChIKey: DNHNYEJEVSBLMY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N4O3
Molecular weight182.14 g/mol
IUPAC name3-(hydrazinecarbonyl)pyrazine-2-carboxylic acid
InChIKeyDNHNYEJEVSBLMY-UHFFFAOYSA-N
SMILESC1=CN=C(C(=N1)C(=O)NN)C(=O)O

Computed by PubChem (NCBI)