CAS 1189480-64-5 appears in our catalog under these names: 1-Methyluric Acid-d3, >95% (HPLC), 1-Methyluric acid-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1-(trideuteriomethyl)-7,9-dihydro-3H-purine-2,6,8-trione (CAS 1189480-64-5) is a chemical compound with the molecular formula C6H6N4O3 and a molecular weight of 185.16 g/mol. IUPAC name: 1-(trideuteriomethyl)-7,9-dihydro-3H-purine-2,6,8-trione. InChIKey: QFDRTQONISXGJA-FIBGUPNXSA-N.
| Molecular formula | C6H6N4O3 |
|---|---|
| Molecular weight | 185.16 g/mol |
| IUPAC name | 1-(trideuteriomethyl)-7,9-dihydro-3H-purine-2,6,8-trione |
| InChIKey | QFDRTQONISXGJA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2=C(NC(=O)N2)NC1=O |
Computed by PubChem (NCBI)