Products 1173019-10-7
CAS 1173019-10-7 appears in our catalog under these names: 3-Methyluric acid-2,4,5,6-13C4, 1,3,9-15N3, 3-Methyluric Acid-13C4,15N3, 99.5%, 3-Methyluric acid-2,4,5,6-13C4, 1,3,9-15. Offered by: Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 2 mg, 2MG.
3-methyl-7,9-dihydropurine-2,6,8-trione (CAS 1173019-10-7) is a chemical compound with the molecular formula C6H6N4O3 and a molecular weight of 189.09 g/mol. IUPAC name: 3-methyl-7,9-dihydropurine-2,6,8-trione. InChIKey: ODCYDGXXCHTFIR-BYSJPOJGSA-N.
| Molecular formula | C6H6N4O3 |
|---|---|
| Molecular weight | 189.09 g/mol |
| IUPAC name | 3-methyl-7,9-dihydropurine-2,6,8-trione |
| InChIKey | ODCYDGXXCHTFIR-BYSJPOJGSA-N |
| SMILES | C[15N]1[13C]2=[13C]([13C](=O)[15NH][13C]1=O)NC(=O)[15NH]2 |
Computed by PubChem (NCBI)