Products 2716077-17-5
CAS 2716077-17-5 is the registry number for F0045(S). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,4-dichlorophenyl)-[(2S)-2-phenylmorpholin-4-yl]methanone (CAS 2716077-17-5) is a chemical compound with the molecular formula C17H15Cl2NO2 and a molecular weight of 336.2 g/mol. IUPAC name: (2,4-dichlorophenyl)-[(2S)-2-phenylmorpholin-4-yl]methanone. InChIKey: GMCUGOLAHOHCSS-MRXNPFEDSA-N.
| Molecular formula | C17H15Cl2NO2 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-[(2S)-2-phenylmorpholin-4-yl]methanone |
| InChIKey | GMCUGOLAHOHCSS-MRXNPFEDSA-N |
| SMILES | C1CO[C@H](CN1C(=O)C2=C(C=C(C=C2)Cl)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)