CAS 543737-13-9 is the registry number for 3-(6,8-Dichloro-2-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzoic acid (CAS 543737-13-9) is a chemical compound with the molecular formula C17H15Cl2NO2 and a molecular weight of 336.2 g/mol. IUPAC name: 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzoic acid. InChIKey: ROCHTQWNNZUYOK-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2NO2 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzoic acid |
| InChIKey | ROCHTQWNNZUYOK-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(C1)C(=CC(=C2)Cl)Cl)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)