CAS 27179-28-8 appears in our catalog under these names: Delta 11-Tetrahydrocannabinol, delta11-Tetrahydrocannabinol (delta11-THC) 100 µg/mL in Methanol, delta11-Tetrahydrocannabinol (delta11-THC) 1000 µg/mL in Methanol, exo–THC (CRM). Offered by: Chemat Brand, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 1ml, 1mg.
(6aR,10aR)-6,6-dimethyl-9-methylidene-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol (CAS 27179-28-8) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (6aR,10aR)-6,6-dimethyl-9-methylidene-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol. InChIKey: AOYYFUGUUIRBML-IAGOWNOFSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (6aR,10aR)-6,6-dimethyl-9-methylidene-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol |
| InChIKey | AOYYFUGUUIRBML-IAGOWNOFSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3CC(=C)CC[C@H]3C(OC2=C1)(C)C)O |
Computed by PubChem (NCBI)