Products 2719746-82-2

CAS 2719746-82-2 is the registry number for Rel-(2S,4R)-4-hydroxytetrahydro-2H-pyran-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S,4R)-4-hydroxyoxane-2-carboxylic acid (CAS 2719746-82-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (2S,4R)-4-hydroxyoxane-2-carboxylic acid. InChIKey: DEPUUQSGAIWFJE-UHNVWZDZSA-N.

Identity
Molecular formulaC6H10O4
Molecular weight146.14 g/mol
IUPAC name(2S,4R)-4-hydroxyoxane-2-carboxylic acid
InChIKeyDEPUUQSGAIWFJE-UHNVWZDZSA-N
SMILESC1CO[C@@H](C[C@@H]1O)C(=O)O

Computed by PubChem (NCBI)