Products 2719762-54-4
CAS 2719762-54-4 is the registry number for (αS)-4-Ethoxy-α-[(1S)-1-methylpropyl]-1H-1,2,3-triazole-1-acetic acid, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
(2S,3S)-2-(4-ethoxytriazol-1-yl)-3-methylpentanoic acid (CAS 2719762-54-4) is a chemical compound with the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. IUPAC name: (2S,3S)-2-(4-ethoxytriazol-1-yl)-3-methylpentanoic acid. InChIKey: UHSIOLOHPRQBCM-CBAPKCEASA-N.
| Molecular formula | C10H17N3O3 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | (2S,3S)-2-(4-ethoxytriazol-1-yl)-3-methylpentanoic acid |
| InChIKey | UHSIOLOHPRQBCM-CBAPKCEASA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N1C=C(N=N1)OCC |
Computed by PubChem (NCBI)