CAS 27220-35-5 appears in our catalog under these names: 3,4-Dichloro Miconazole Nitrate, 1-((2RS)-2-((3,4-Dichlorobenzyl)oxy)-2-(2,4-dichlorophenyl)ethyl)-1H-imidazole Nitrate, Miconazole EP Impurity F (as Nitrate). Offered by: TRC, Mikromol. Available pack sizes: 1g, 4x25mg, 25mg, 100mg.
1-[2-(2,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid (CAS 27220-35-5) is a chemical compound with the molecular formula C18H15Cl4N3O4 and a molecular weight of 479.1 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid. InChIKey: MMRLQMTZCNGZQB-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl4N3O4 |
|---|---|
| Molecular weight | 479.1 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-[(3,4-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid |
| InChIKey | MMRLQMTZCNGZQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl)Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)