CAS 909277-72-1 appears in our catalog under these names: 2,5-Dichloro Miconazole Nitrate, >95% (HPLC), Miconazole EP Impurity G (as Nitrate). Offered by: TRC, Mikromol. Available pack sizes: 100mg, 1g, 25mg.
1-[2-(2,4-dichlorophenyl)-2-[(2,5-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid (CAS 909277-72-1) is a chemical compound with the molecular formula C18H15Cl4N3O4 and a molecular weight of 479.1 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-[(2,5-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid. InChIKey: FRLSOOILEKZTFN-UHFFFAOYSA-N.
| Molecular formula | C18H15Cl4N3O4 |
|---|---|
| Molecular weight | 479.1 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-[(2,5-dichlorophenyl)methoxy]ethyl]imidazole;nitric acid |
| InChIKey | FRLSOOILEKZTFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=CN=C2)OCC3=C(C=CC(=C3)Cl)Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)