Products 272442-14-5
CAS 272442-14-5 appears in our catalog under these names: Hexadecanoic-9,9-d2 Acid, 98 atom % D, min 98% Chemical Purity, Palmitic acid-d2-2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1mg, 5mg.
9,9-dideuteriohexadecanoic acid (CAS 272442-14-5) is a chemical compound with the molecular formula C16H32O2 and a molecular weight of 258.44 g/mol. IUPAC name: 9,9-dideuteriohexadecanoic acid. InChIKey: IPCSVZSSVZVIGE-MGVXTIMCSA-N.
| Molecular formula | C16H32O2 |
|---|---|
| Molecular weight | 258.44 g/mol |
| IUPAC name | 9,9-dideuteriohexadecanoic acid |
| InChIKey | IPCSVZSSVZVIGE-MGVXTIMCSA-N |
| SMILES | [2H]C([2H])(CCCCCCC)CCCCCCCC(=O)O |
Computed by PubChem (NCBI)