Products 272458-63-6
CAS 272458-63-6 is the registry number for Dexibuprofen Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Ethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (CAS 272458-63-6) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: ethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate. InChIKey: HXTFUVWJFLDLJP-LBPRGKRZSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | ethyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| InChIKey | HXTFUVWJFLDLJP-LBPRGKRZSA-N |
| SMILES | CCOC(=O)[C@@H](C)C1=CC=C(C=C1)CC(C)C |
Computed by PubChem (NCBI)