CAS 2724689-64-7 is the registry number for Doxylamine N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 100mg.
N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide;hydrochloride (CAS 2724689-64-7) is a chemical compound with the molecular formula C17H23ClN2O2 and a molecular weight of 322.8 g/mol. IUPAC name: N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide;hydrochloride. InChIKey: ASKZZGORDSFRGC-UHFFFAOYSA-N.
| Molecular formula | C17H23ClN2O2 |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide;hydrochloride |
| InChIKey | ASKZZGORDSFRGC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=N2)OCC[N+](C)(C)[O-].Cl |
Computed by PubChem (NCBI)