Products 807316-60-5

CAS 807316-60-5 is the registry number for 4-(2-(Chloromethyl)benzimidazol-1-yl)butyl pivalate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

4-[2-(chloromethyl)benzimidazol-1-yl]butyl 2,2-dimethylpropanoate (CAS 807316-60-5) is a chemical compound with the molecular formula C17H23ClN2O2 and a molecular weight of 322.8 g/mol. IUPAC name: 4-[2-(chloromethyl)benzimidazol-1-yl]butyl 2,2-dimethylpropanoate. InChIKey: BZVXSAXQSWSMBF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23ClN2O2
Molecular weight322.8 g/mol
IUPAC name4-[2-(chloromethyl)benzimidazol-1-yl]butyl 2,2-dimethylpropanoate
InChIKeyBZVXSAXQSWSMBF-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)OCCCCN1C2=CC=CC=C2N=C1CCl

Computed by PubChem (NCBI)