CAS 2724689-95-4 is the registry number for (2RS)-2-((2,4-Dichlorobenzyl)oxy)-2-(2,4-dichloro-phenyl)ethanamine Nitrate. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethanamine;nitric acid (CAS 2724689-95-4) is a chemical compound with the molecular formula C15H14Cl4N2O4 and a molecular weight of 428.1 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethanamine;nitric acid. InChIKey: AATUWHNKLAXCOK-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl4N2O4 |
|---|---|
| Molecular weight | 428.1 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethanamine;nitric acid |
| InChIKey | AATUWHNKLAXCOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)COC(CN)C2=C(C=C(C=C2)Cl)Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)