CAS 2726492-80-2 appears in our catalog under these names: (2RS)-2-((2,6-Dichlorobenzyl)oxy)-2-(2,4-dichlorophenyl)ethanamine Nitrate, Isoconazole EP Impurity B (as Nitrate). Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethanamine;nitric acid (CAS 2726492-80-2) is a chemical compound with the molecular formula C15H14Cl4N2O4 and a molecular weight of 428.1 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethanamine;nitric acid. InChIKey: XIYRULGUOHWBMG-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl4N2O4 |
|---|---|
| Molecular weight | 428.1 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethanamine;nitric acid |
| InChIKey | XIYRULGUOHWBMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)COC(CN)C2=C(C=C(C=C2)Cl)Cl)Cl.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)