CAS 2725355-17-7 is the registry number for Cyclizine N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
4-benzhydryl-1-methyl-1-oxidopiperazin-1-ium;dihydrochloride (CAS 2725355-17-7) is a chemical compound with the molecular formula C18H24Cl2N2O and a molecular weight of 355.3 g/mol. IUPAC name: 4-benzhydryl-1-methyl-1-oxidopiperazin-1-ium;dihydrochloride. InChIKey: WWIJFYVLWUQINI-UHFFFAOYSA-N.
| Molecular formula | C18H24Cl2N2O |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | 4-benzhydryl-1-methyl-1-oxidopiperazin-1-ium;dihydrochloride |
| InChIKey | WWIJFYVLWUQINI-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3)[O-].Cl.Cl |
Computed by PubChem (NCBI)