Products 2740524-43-8
CAS 2740524-43-8 appears in our catalog under these names: 4–Dimethylamino–N–benzylcathinone (hydrochloride), 1-[4-(Dimethylamino)phenyl]-2-[(phenylmethyl)amino]-1-propanone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
2-(benzylamino)-1-[4-(dimethylamino)phenyl]propan-1-one;dihydrochloride (CAS 2740524-43-8) is a chemical compound with the molecular formula C18H24Cl2N2O and a molecular weight of 355.3 g/mol. IUPAC name: 2-(benzylamino)-1-[4-(dimethylamino)phenyl]propan-1-one;dihydrochloride. InChIKey: IHYZNFBEYCRGTM-UHFFFAOYSA-N.
| Molecular formula | C18H24Cl2N2O |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | 2-(benzylamino)-1-[4-(dimethylamino)phenyl]propan-1-one;dihydrochloride |
| InChIKey | IHYZNFBEYCRGTM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)N(C)C)NCC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)