CAS 2725791-06-8 is the registry number for benzyl endo-6-hydroxy-3-azabicyclo[3.1.1]heptane-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Benzyl (1R,5S)-6-hydroxy-3-azabicyclo[3.1.1]heptane-3-carboxylate (CAS 2725791-06-8) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl (1R,5S)-6-hydroxy-3-azabicyclo[3.1.1]heptane-3-carboxylate. InChIKey: VVOXZFXJAYBFQB-FUNVUKJBSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl (1R,5S)-6-hydroxy-3-azabicyclo[3.1.1]heptane-3-carboxylate |
| InChIKey | VVOXZFXJAYBFQB-FUNVUKJBSA-N |
| SMILES | C1[C@@H]2CN(C[C@H]1C2O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)