CAS 2725791-07-9 is the registry number for 7-Methyl-7-azaspiro(3.5)nonan-2-amine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
7-methyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride (CAS 2725791-07-9) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: 7-methyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride. InChIKey: HQIUXMBTQDWNJX-UHFFFAOYSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 7-methyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride |
| InChIKey | HQIUXMBTQDWNJX-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)CC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)