CAS 2730879-17-9 is the registry number for 7-Iodo-4-isopropylpyrrolo[1,2-d][1,2,4]triazin-1(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-iodo-4-propan-2-yl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one (CAS 2730879-17-9) is a chemical compound with the molecular formula C9H10IN3O and a molecular weight of 303.10 g/mol. IUPAC name: 7-iodo-4-propan-2-yl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one. InChIKey: LJYWIZURVVXFJP-UHFFFAOYSA-N.
| Molecular formula | C9H10IN3O |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 7-iodo-4-propan-2-yl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one |
| InChIKey | LJYWIZURVVXFJP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NNC(=O)C2=CC(=CN21)I |
Computed by PubChem (NCBI)