CAS 957194-64-8 is the registry number for 7-Iodo-3,3-dimethyl-3,4-dihydropyrido(2,3-b)pyrazin-2(1H)-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-iodo-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one (CAS 957194-64-8) is a chemical compound with the molecular formula C9H10IN3O and a molecular weight of 303.10 g/mol. IUPAC name: 7-iodo-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one. InChIKey: KTLWPEOJBCZLPP-UHFFFAOYSA-N.
| Molecular formula | C9H10IN3O |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 7-iodo-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one |
| InChIKey | KTLWPEOJBCZLPP-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(N1)N=CC(=C2)I)C |
Computed by PubChem (NCBI)