Products 2731375-50-9
CAS 2731375-50-9 is the registry number for 4-((1RS)-1,3-Dimethylbutyl)-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one. Offered by: Mikromol. Available pack sizes: 25mg.
1,5-dimethyl-4-(4-methylpentan-2-yl)-2-phenylpyrazol-3-one (CAS 2731375-50-9) is a chemical compound with the molecular formula C17H24N2O and a molecular weight of 272.4 g/mol. IUPAC name: 1,5-dimethyl-4-(4-methylpentan-2-yl)-2-phenylpyrazol-3-one. InChIKey: AHKJXHYOTWRIKD-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 1,5-dimethyl-4-(4-methylpentan-2-yl)-2-phenylpyrazol-3-one |
| InChIKey | AHKJXHYOTWRIKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)C(C)CC(C)C |
Computed by PubChem (NCBI)