CAS 938071-77-3 is the registry number for (E)-1-(4-(4-(2-Methylbut-2-en-1-yl)piperazin-1-yl)phenyl)ethanone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone (CAS 938071-77-3) is a chemical compound with the molecular formula C17H24N2O and a molecular weight of 272.4 g/mol. IUPAC name: 1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone. InChIKey: SBANNMOEYYSRDA-LNKIKWGQSA-N.
| Molecular formula | C17H24N2O |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 1-[4-[4-[(E)-2-methylbut-2-enyl]piperazin-1-yl]phenyl]ethanone |
| InChIKey | SBANNMOEYYSRDA-LNKIKWGQSA-N |
| SMILES | C/C=C(\C)/CN1CCN(CC1)C2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)