Products 2731552-41-1

CAS 2731552-41-1 is the registry number for 4-(Trifluoromethyl)benzoic acid-13C6, 98.31%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 2731552-41-1) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 196.08 g/mol. IUPAC name: 4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: SWKPKONEIZGROQ-IDEBNGHGSA-N.

Identity
Molecular formulaC8H5F3O2
Molecular weight196.08 g/mol
IUPAC name4-(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid
InChIKeySWKPKONEIZGROQ-IDEBNGHGSA-N
SMILES[13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)