Products 2731709-45-6

CAS 2731709-45-6 is the registry number for Flunixin Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate (CAS 2731709-45-6) is a chemical compound with the molecular formula C17H17F3N2O2 and a molecular weight of 338.32 g/mol. IUPAC name: propan-2-yl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate. InChIKey: JVTKBENZUOTMJR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17F3N2O2
Molecular weight338.32 g/mol
IUPAC namepropan-2-yl 2-[2-methyl-3-(trifluoromethyl)anilino]pyridine-3-carboxylate
InChIKeyJVTKBENZUOTMJR-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)OC(C)C)C(F)(F)F

Computed by PubChem (NCBI)