CAS 273222-02-9 appears in our catalog under these names: 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(pyridin-4-yl)butanoic acid, 95%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(pyridin-4-yl)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-4-ylbutanoic acid (CAS 273222-02-9) is a chemical compound with the molecular formula C24H22N2O4 and a molecular weight of 402.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-4-ylbutanoic acid. InChIKey: FKBUYAZUIRMSJK-UHFFFAOYSA-N.
| Molecular formula | C24H22N2O4 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-4-ylbutanoic acid |
| InChIKey | FKBUYAZUIRMSJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC4=CC=NC=C4)C(=O)O |
Computed by PubChem (NCBI)