Products 2732762-46-6
CAS 2732762-46-6 is the registry number for 4-Hydroxypiperidine-d9 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride (CAS 2732762-46-6) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 146.66 g/mol. IUPAC name: 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride. InChIKey: VKCORPXOKYDINR-PGXDZSOZSA-N.
| Molecular formula | C5H12ClNO |
|---|---|
| Molecular weight | 146.66 g/mol |
| IUPAC name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride |
| InChIKey | VKCORPXOKYDINR-PGXDZSOZSA-N |
| SMILES | [2H]C1(C(NC(C(C1([2H])O)([2H])[2H])([2H])[2H])([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)