CAS 2734001-58-0 is the registry number for 4-Hydroxypiperidine-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
3,3,4,5,5-pentadeuteriopiperidin-4-ol;hydrochloride (CAS 2734001-58-0) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 142.64 g/mol. IUPAC name: 3,3,4,5,5-pentadeuteriopiperidin-4-ol;hydrochloride. InChIKey: VKCORPXOKYDINR-JTWFYWLFSA-N.
| Molecular formula | C5H12ClNO |
|---|---|
| Molecular weight | 142.64 g/mol |
| IUPAC name | 3,3,4,5,5-pentadeuteriopiperidin-4-ol;hydrochloride |
| InChIKey | VKCORPXOKYDINR-JTWFYWLFSA-N |
| SMILES | [2H]C1(CNCC(C1([2H])O)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)