CAS 2733387-38-5 is the registry number for Atrazine-desethyl D6 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
6-chloro-2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine (CAS 2733387-38-5) is a chemical compound with the molecular formula C6H10ClN5 and a molecular weight of 193.67 g/mol. IUPAC name: 6-chloro-2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine. InChIKey: DFWFIQKMSFGDCQ-WFGJKAKNSA-N.
| Molecular formula | C6H10ClN5 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 6-chloro-2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| InChIKey | DFWFIQKMSFGDCQ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NC1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)