Products 2733718-39-1

CAS 2733718-39-1 is the registry number for Alachlor D3 (methoxy D3) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

2-chloro-N-(2,6-diethylphenyl)-N-(trideuteriomethoxymethyl)acetamide (CAS 2733718-39-1) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 272.78 g/mol. IUPAC name: 2-chloro-N-(2,6-diethylphenyl)-N-(trideuteriomethoxymethyl)acetamide. InChIKey: XCSGPAVHZFQHGE-HPRDVNIFSA-N.

Identity
Molecular formulaC14H20ClNO2
Molecular weight272.78 g/mol
IUPAC name2-chloro-N-(2,6-diethylphenyl)-N-(trideuteriomethoxymethyl)acetamide
InChIKeyXCSGPAVHZFQHGE-HPRDVNIFSA-N
SMILES[2H]C([2H])([2H])OCN(C1=C(C=CC=C1CC)CC)C(=O)CCl

Computed by PubChem (NCBI)